C20H26N2O5 — CID 7347954
2-methylpropyl N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(furan-2-carbonyl)carbamimidate (PubChem CID 7347954) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-methylpropyl N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(furan-2-carbonyl)carbamimidate.
| Compound Name | 2-methylpropyl N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(furan-2-carbonyl)carbamimidate |
|---|---|
| PubChem CID | 7347954 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-methylpropyl N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(furan-2-carbonyl)carbamimidate |
| SMILES | COc1ccc(CC/N=C(/NC(=O)c2ccco2)OCC(C)C)cc1OC |
| InChI | InChI=1S/C20H26N2O5/c1-14(2)13-27-20(22-19(23)17-6-5-11-26-17)21-10-9-15-7-8-16(24-3)18(12-15)25-4/h5-8,11-12,14H,9-10,13H2,1-4H3,(H,21,22,23) |
| InChIKey | FMISLHSBEBRQPO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|