C21H21NO6 — CID 2818039
[4-[3-(furan-2-carbonylamino)butyl]-2-methoxyphenyl] furan-2-carboxylate (PubChem CID 2818039) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is [4-[3-(furan-2-carbonylamino)butyl]-2-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[3-(furan-2-carbonylamino)butyl]-2-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2818039 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | [4-[3-(furan-2-carbonylamino)butyl]-2-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1cc(CCC(C)NC(=O)c2ccco2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C21H21NO6/c1-14(22-20(23)17-5-3-11-26-17)7-8-15-9-10-16(19(13-15)25-2)28-21(24)18-6-4-12-27-18/h3-6,9-14H,7-8H2,1-2H3,(H,22,23) |
| InChIKey | DAJHWCFJZKGXPL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 90.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|