C18H28N3O4+ — CID 7226715
2-methoxyethyl N-(4-methoxybenzoyl)-N'-(2-pyrrolidin-1-ium-1-ylethyl)carbamimidate (PubChem CID 7226715) has the molecular formula C18H28N3O4+ and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-methoxyethyl N-(4-methoxybenzoyl)-N'-(2-pyrrolidin-1-ium-1-ylethyl)carbamimidate.
| Compound Name | 2-methoxyethyl N-(4-methoxybenzoyl)-N'-(2-pyrrolidin-1-ium-1-ylethyl)carbamimidate |
|---|---|
| PubChem CID | 7226715 |
| Molecular Formula | C18H28N3O4+ |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 2-methoxyethyl N-(4-methoxybenzoyl)-N'-(2-pyrrolidin-1-ium-1-ylethyl)carbamimidate |
| SMILES | COCCO/C(=N\CC[NH+]1CCCC1)NC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H27N3O4/c1-23-13-14-25-18(19-9-12-21-10-3-4-11-21)20-17(22)15-5-7-16(24-2)8-6-15/h5-8H,3-4,9-14H2,1-2H3,(H,19,20,22)/p+1 |
| InChIKey | NRYQQECRXLKDNP-UHFFFAOYSA-O |
| XLogP | 0.12 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|