C15H22ClN3O2 — CID 5165368
propan-2-yl N-(2-chlorobenzoyl)-N'-[2-(dimethylamino)ethyl]carbamimidate (PubChem CID 5165368) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is propan-2-yl N-(2-chlorobenzoyl)-N'-[2-(dimethylamino)ethyl]carbamimidate.
| Compound Name | propan-2-yl N-(2-chlorobenzoyl)-N'-[2-(dimethylamino)ethyl]carbamimidate |
|---|---|
| PubChem CID | 5165368 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | propan-2-yl N-(2-chlorobenzoyl)-N'-[2-(dimethylamino)ethyl]carbamimidate |
| SMILES | CC(C)O/C(=N\CCN(C)C)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C15H22ClN3O2/c1-11(2)21-15(17-9-10-19(3)4)18-14(20)12-7-5-6-8-13(12)16/h5-8,11H,9-10H2,1-4H3,(H,17,18,20) |
| InChIKey | KXBFHZAFVZAXHX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|