C16H18N2O2S — CID 7288444
propan-2-yl N'-benzyl-N-(thiophene-2-carbonyl)carbamimidate (PubChem CID 7288444) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is propan-2-yl N'-benzyl-N-(thiophene-2-carbonyl)carbamimidate.
| Compound Name | propan-2-yl N'-benzyl-N-(thiophene-2-carbonyl)carbamimidate |
|---|---|
| PubChem CID | 7288444 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | propan-2-yl N'-benzyl-N-(thiophene-2-carbonyl)carbamimidate |
| SMILES | CC(C)O/C(=N\Cc1ccccc1)NC(=O)c1cccs1 |
| InChI | InChI=1S/C16H18N2O2S/c1-12(2)20-16(17-11-13-7-4-3-5-8-13)18-15(19)14-9-6-10-21-14/h3-10,12H,11H2,1-2H3,(H,17,18,19) |
| InChIKey | SXMVBXOCAHHTFW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|