C12H18N2O3S — CID 7361978
2-methoxyethyl N'-propyl-N-(thiophene-2-carbonyl)carbamimidate (PubChem CID 7361978) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-methoxyethyl N'-propyl-N-(thiophene-2-carbonyl)carbamimidate.
| Compound Name | 2-methoxyethyl N'-propyl-N-(thiophene-2-carbonyl)carbamimidate |
|---|---|
| PubChem CID | 7361978 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-methoxyethyl N'-propyl-N-(thiophene-2-carbonyl)carbamimidate |
| SMILES | CCC/N=C(/NC(=O)c1cccs1)OCCOC |
| InChI | InChI=1S/C12H18N2O3S/c1-3-6-13-12(17-8-7-16-2)14-11(15)10-5-4-9-18-10/h4-5,9H,3,6-8H2,1-2H3,(H,13,14,15) |
| InChIKey | WPLWTAJHUBWCTG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|