C17H30N3O2S+ — CID 7396572
[(4S)-4-[[ethoxy-(thiophene-2-carbonylamino)methylidene]amino]pentyl]-diethylazanium (PubChem CID 7396572) has the molecular formula C17H30N3O2S+ and a molecular weight of 340.51 g/mol. Its IUPAC name is [(4S)-4-[[ethoxy-(thiophene-2-carbonylamino)methylidene]amino]pentyl]-diethylazanium.
| Compound Name | [(4S)-4-[[ethoxy-(thiophene-2-carbonylamino)methylidene]amino]pentyl]-diethylazanium |
|---|---|
| PubChem CID | 7396572 |
| Molecular Formula | C17H30N3O2S+ |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | [(4S)-4-[[ethoxy-(thiophene-2-carbonylamino)methylidene]amino]pentyl]-diethylazanium |
| SMILES | CCO/C(=N\[C@@H](C)CCC[NH+](CC)CC)NC(=O)c1cccs1 |
| InChI | InChI=1S/C17H29N3O2S/c1-5-20(6-2)12-8-10-14(4)18-17(22-7-3)19-16(21)15-11-9-13-23-15/h9,11,13-14H,5-8,10,12H2,1-4H3,(H,18,19,21)/p+1/t14-/m0/s1 |
| InChIKey | OAJWCWZYEUXCNZ-AWEZNQCLSA-O |
| XLogP | 1.96 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|