C48H57NO12 — CID 68593091
2-[bis[2-[(1S,2R)-2-benzoyl-2-hydroxycyclohexanecarbonyl]oxyethyl]amino]ethyl 2-benzoyl-2-hydroxycyclohexane-1-carboxylate (PubChem CID 68593091) has the molecular formula C48H57NO12 and a molecular weight of 839.98 g/mol. Its IUPAC name is 2-[bis[2-[(1S,2R)-2-benzoyl-2-hydroxycyclohexanecarbonyl]oxyethyl]amino]ethyl 2-benzoyl-2-hydroxycyclohexane-1-carboxylate.
| Compound Name | 2-[bis[2-[(1S,2R)-2-benzoyl-2-hydroxycyclohexanecarbonyl]oxyethyl]amino]ethyl 2-benzoyl-2-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 68593091 |
| Molecular Formula | C48H57NO12 |
| Molecular Weight | 839.98 g/mol |
| Exact Mass | 839.39 |
| IUPAC Name | 2-[bis[2-[(1S,2R)-2-benzoyl-2-hydroxycyclohexanecarbonyl]oxyethyl]amino]ethyl 2-benzoyl-2-hydroxycyclohexane-1-carboxylate |
| SMILES | O=C(OCCN(CCOC(=O)[C@H]1CCCC[C@]1(O)C(=O)c1ccccc1)CCOC(=O)[C@H]1CCCC[C@]1(O)C(=O)c1ccccc1)C1CCCCC1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C48H57NO12/c50-40(34-16-4-1-5-17-34)46(56)25-13-10-22-37(46)43(53)59-31-28-49(29-32-60-44(54)38-23-11-14-26-47(38,57)41(51)35-18-6-2-7-19-35)30-33-61-45(55)39-24-12-15-27-48(39,58)42(52)36-20-8-3-9-21-36/h1-9,16-21,37-39,56-58H,10-15,22-33H2/t37-,38-,39?,46-,47-,48?/m1/s1 |
| InChIKey | YWVMBSIOWDSPNV-JNIUMXTFSA-N |
| XLogP | 5.33 |
| TPSA | 194.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.98 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|