C24H29NO8 — CID 10983385
cis-triethyl (2R,3S)-3-cyano-2-[2-(4-methoxyphenyl)-2-oxoethyl]cyclopentane-1,1,3-tricarboxylate (PubChem CID 10983385) has the molecular formula C24H29NO8 and a molecular weight of 459.50 g/mol. Its IUPAC name is cis-triethyl (2R,3S)-3-cyano-2-[2-(4-methoxyphenyl)-2-oxoethyl]cyclopentane-1,1,3-tricarboxylate.
| Compound Name | cis-triethyl (2R,3S)-3-cyano-2-[2-(4-methoxyphenyl)-2-oxoethyl]cyclopentane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 10983385 |
| Molecular Formula | C24H29NO8 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | cis-triethyl (2R,3S)-3-cyano-2-[2-(4-methoxyphenyl)-2-oxoethyl]cyclopentane-1,1,3-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC[C@](C#N)(C(=O)OCC)[C@H]1CC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H29NO8/c1-5-31-20(27)23(15-25)12-13-24(21(28)32-6-2,22(29)33-7-3)19(23)14-18(26)16-8-10-17(30-4)11-9-16/h8-11,19H,5-7,12-14H2,1-4H3/t19-,23-/m1/s1 |
| InChIKey | ATHWJSVWENXMIU-AUSIDOKSSA-N |
| XLogP | 2.86 |
| TPSA | 128.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|