C13H18N2O5 — CID 10684286
ethyl (1S,2R,3S)-1-cyano-3-methyl-3-nitro-2-(2-oxopropyl)cyclopentane-1-carboxylate (PubChem CID 10684286) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is ethyl (1S,2R,3S)-1-cyano-3-methyl-3-nitro-2-(2-oxopropyl)cyclopentane-1-carboxylate.
| Compound Name | ethyl (1S,2R,3S)-1-cyano-3-methyl-3-nitro-2-(2-oxopropyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 10684286 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | ethyl (1S,2R,3S)-1-cyano-3-methyl-3-nitro-2-(2-oxopropyl)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C#N)CC[C@](C)([N+](=O)[O-])[C@@H]1CC(C)=O |
| InChI | InChI=1S/C13H18N2O5/c1-4-20-11(17)13(8-14)6-5-12(3,15(18)19)10(13)7-9(2)16/h10H,4-7H2,1-3H3/t10-,12-,13+/m0/s1 |
| InChIKey | NRGRMPKZPAROMW-WCFLWFBJSA-N |
| XLogP | 1.48 |
| TPSA | 110.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|