C28H36O8 — CID 23634722
tetraethyl (4E,5Z)-4-ethylidene-5-(1-phenylethylidene)cyclohexane-1,1,2,2-tetracarboxylate (PubChem CID 23634722) has the molecular formula C28H36O8 and a molecular weight of 500.59 g/mol. Its IUPAC name is tetraethyl (4E,5Z)-4-ethylidene-5-(1-phenylethylidene)cyclohexane-1,1,2,2-tetracarboxylate.
| Compound Name | tetraethyl (4E,5Z)-4-ethylidene-5-(1-phenylethylidene)cyclohexane-1,1,2,2-tetracarboxylate |
|---|---|
| PubChem CID | 23634722 |
| Molecular Formula | C28H36O8 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | tetraethyl (4E,5Z)-4-ethylidene-5-(1-phenylethylidene)cyclohexane-1,1,2,2-tetracarboxylate |
| SMILES | C/C=C1\CC(C(=O)OCC)(C(=O)OCC)C(C(=O)OCC)(C(=O)OCC)C\C1=C(/C)c1ccccc1 |
| InChI | InChI=1S/C28H36O8/c1-7-20-17-27(23(29)33-8-2,24(30)34-9-3)28(25(31)35-10-4,26(32)36-11-5)18-22(20)19(6)21-15-13-12-14-16-21/h7,12-16H,8-11,17-18H2,1-6H3/b20-7+,22-19- |
| InChIKey | OCHKPNWHMQBQDZ-OIRWBWIFSA-N |
| XLogP | 4.43 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|