C14H20O5 — CID 146163835
diethyl 4-oxobicyclo[3.2.1]octane-6,6-dicarboxylate (PubChem CID 146163835) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is diethyl 4-oxobicyclo[3.2.1]octane-6,6-dicarboxylate.
| Compound Name | diethyl 4-oxobicyclo[3.2.1]octane-6,6-dicarboxylate |
|---|---|
| PubChem CID | 146163835 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | diethyl 4-oxobicyclo[3.2.1]octane-6,6-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2CCC(=O)C1C2 |
| InChI | InChI=1S/C14H20O5/c1-3-18-12(16)14(13(17)19-4-2)8-9-5-6-11(15)10(14)7-9/h9-10H,3-8H2,1-2H3 |
| InChIKey | GVGLKVCBKBEMLJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|