C16H22O4 — CID 11055002
ethyl 8-hydroxy-6-oxo-2-propan-2-ylidenetricyclo[5.2.1.03,8]decane-1-carboxylate (PubChem CID 11055002) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is ethyl 8-hydroxy-6-oxo-2-propan-2-ylidenetricyclo[5.2.1.03,8]decane-1-carboxylate.
| Compound Name | ethyl 8-hydroxy-6-oxo-2-propan-2-ylidenetricyclo[5.2.1.03,8]decane-1-carboxylate |
|---|---|
| PubChem CID | 11055002 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | ethyl 8-hydroxy-6-oxo-2-propan-2-ylidenetricyclo[5.2.1.03,8]decane-1-carboxylate |
| SMILES | CCOC(=O)C12CC3C(=O)CCC(C1=C(C)C)C3(O)C2 |
| InChI | InChI=1S/C16H22O4/c1-4-20-14(18)15-7-11-12(17)6-5-10(13(15)9(2)3)16(11,19)8-15/h10-11,19H,4-8H2,1-3H3 |
| InChIKey | LLUUYDFZJNJESO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|