About ethyl 1-(ethylamino)-3,5-dimethylcyclohexane-1-carboxylate
ethyl 1-(ethylamino)-3,5-dimethylcyclohexane-1-carboxylate (PubChem CID 64750726) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is ethyl 1-(ethylamino)-3,5-dimethylcyclohexane-1-carboxylate.
Analyze ethyl 1-(ethylamino)-3,5-dimethylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(ethylamino)-3,5-dimethylcyclohexane-1-carboxylate?
The IUPAC name of ethyl 1-(ethylamino)-3,5-dimethylcyclohexane-1-carboxylate (CID 64750726) is ethyl 1-(ethylamino)-3,5-dimethylcyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 1-(ethylamino)-3,5-dimethylcyclohexane-1-carboxylate?
The canonical SMILES for ethyl 1-(ethylamino)-3,5-dimethylcyclohexane-1-carboxylate is CCNC1(C(=O)OCC)CC(C)CC(C)C1.
What is the InChIKey of ethyl 1-(ethylamino)-3,5-dimethylcyclohexane-1-carboxylate?
The InChIKey is NMRRCYLVKVYLCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-5-14-13(12(15)16-6-2)8-10(3)7-11(4)9-13/h10-11,14H,5-9H2,1-4H3.
What are the key properties of ethyl 1-(ethylamino)-3,5-dimethylcyclohexane-1-carboxylate?
ethyl 1-(ethylamino)-3,5-dimethylcyclohexane-1-carboxylate has a molecular weight of 227.35 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(ethylamino)-3,5-dimethylcyclohexane-1-carboxylate is sourced from PubChem (CID 64750726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).