About methyl 1-(ethylamino)-3,3,5-trimethylcyclohexane-1-carboxylate
methyl 1-(ethylamino)-3,3,5-trimethylcyclohexane-1-carboxylate (PubChem CID 60787698) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is methyl 1-(ethylamino)-3,3,5-trimethylcyclohexane-1-carboxylate.
Analyze methyl 1-(ethylamino)-3,3,5-trimethylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(ethylamino)-3,3,5-trimethylcyclohexane-1-carboxylate?
The IUPAC name of methyl 1-(ethylamino)-3,3,5-trimethylcyclohexane-1-carboxylate (CID 60787698) is methyl 1-(ethylamino)-3,3,5-trimethylcyclohexane-1-carboxylate.
What is the SMILES notation for methyl 1-(ethylamino)-3,3,5-trimethylcyclohexane-1-carboxylate?
The canonical SMILES for methyl 1-(ethylamino)-3,3,5-trimethylcyclohexane-1-carboxylate is CCNC1(C(=O)OC)CC(C)CC(C)(C)C1.
What is the InChIKey of methyl 1-(ethylamino)-3,3,5-trimethylcyclohexane-1-carboxylate?
The InChIKey is XKYGWQYMCXBNBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-6-14-13(11(15)16-5)8-10(2)7-12(3,4)9-13/h10,14H,6-9H2,1-5H3.
What are the key properties of methyl 1-(ethylamino)-3,3,5-trimethylcyclohexane-1-carboxylate?
methyl 1-(ethylamino)-3,3,5-trimethylcyclohexane-1-carboxylate has a molecular weight of 227.35 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(ethylamino)-3,3,5-trimethylcyclohexane-1-carboxylate is sourced from PubChem (CID 60787698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).