About ethyl 1-(2-bromoanilino)-3,5-dimethylcyclohexane-1-carboxylate
ethyl 1-(2-bromoanilino)-3,5-dimethylcyclohexane-1-carboxylate (PubChem CID 64752668) has the molecular formula C17H24BrNO2
and a molecular weight of 354.29 g/mol. Its IUPAC name is ethyl 1-(2-bromoanilino)-3,5-dimethylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2-bromoanilino)-3,5-dimethylcyclohexane-1-carboxylate |
| PubChem CID | 64752668 |
| Molecular Formula | C17H24BrNO2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | ethyl 1-(2-bromoanilino)-3,5-dimethylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(Nc2ccccc2Br)CC(C)CC(C)C1 |
| InChI | InChI=1S/C17H24BrNO2/c1-4-21-16(20)17(10-12(2)9-13(3)11-17)19-15-8-6-5-7-14(15)18/h5-8,12-13,19H,4,9-11H2,1-3H3 |
| InChIKey | SDNYNTKAQGCFOZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 1-(2-bromoanilino)-3,5-dimethylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2-bromoanilino)-3,5-dimethylcyclohexane-1-carboxylate?
The IUPAC name of ethyl 1-(2-bromoanilino)-3,5-dimethylcyclohexane-1-carboxylate (CID 64752668) is ethyl 1-(2-bromoanilino)-3,5-dimethylcyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 1-(2-bromoanilino)-3,5-dimethylcyclohexane-1-carboxylate?
The canonical SMILES for ethyl 1-(2-bromoanilino)-3,5-dimethylcyclohexane-1-carboxylate is CCOC(=O)C1(Nc2ccccc2Br)CC(C)CC(C)C1.
What is the InChIKey of ethyl 1-(2-bromoanilino)-3,5-dimethylcyclohexane-1-carboxylate?
The InChIKey is SDNYNTKAQGCFOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24BrNO2/c1-4-21-16(20)17(10-12(2)9-13(3)11-17)19-15-8-6-5-7-14(15)18/h5-8,12-13,19H,4,9-11H2,1-3H3.
What are the key properties of ethyl 1-(2-bromoanilino)-3,5-dimethylcyclohexane-1-carboxylate?
ethyl 1-(2-bromoanilino)-3,5-dimethylcyclohexane-1-carboxylate has a molecular weight of 354.29 g/mol, XLogP of 4.62, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2-bromoanilino)-3,5-dimethylcyclohexane-1-carboxylate is sourced from PubChem (CID 64752668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).