C11H14O5 — CID 121224625
ethyl 6-hydroxy-7,8-dioxospiro[2.5]octane-6-carboxylate (PubChem CID 121224625) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is ethyl 6-hydroxy-7,8-dioxospiro[2.5]octane-6-carboxylate.
| Compound Name | ethyl 6-hydroxy-7,8-dioxospiro[2.5]octane-6-carboxylate |
|---|---|
| PubChem CID | 121224625 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | ethyl 6-hydroxy-7,8-dioxospiro[2.5]octane-6-carboxylate |
| SMILES | CCOC(=O)C1(O)CCC2(CC2)C(=O)C1=O |
| InChI | InChI=1S/C11H14O5/c1-2-16-9(14)11(15)6-5-10(3-4-10)7(12)8(11)13/h15H,2-6H2,1H3 |
| InChIKey | DELYMCFEUAKTBX-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|