C15H20N3O2+ — CID 7071831
(5S,6R,7R)-6,8-dimethyl-7-phenyl-1,3-diaza-8-azoniaspiro[4.5]decane-2,4-dione (PubChem CID 7071831) has the molecular formula C15H20N3O2+ and a molecular weight of 274.34 g/mol. Its IUPAC name is (5S,6R,7R)-6,8-dimethyl-7-phenyl-1,3-diaza-8-azoniaspiro[4.5]decane-2,4-dione.
| Compound Name | (5S,6R,7R)-6,8-dimethyl-7-phenyl-1,3-diaza-8-azoniaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 7071831 |
| Molecular Formula | C15H20N3O2+ |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (5S,6R,7R)-6,8-dimethyl-7-phenyl-1,3-diaza-8-azoniaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@@H]1[C@H](c2ccccc2)[NH+](C)CC[C@]12NC(=O)NC2=O |
| InChI | InChI=1S/C15H19N3O2/c1-10-12(11-6-4-3-5-7-11)18(2)9-8-15(10)13(19)16-14(20)17-15/h3-7,10,12H,8-9H2,1-2H3,(H2,16,17,19,20)/p+1/t10-,12-,15+/m1/s1 |
| InChIKey | FQTIIVLASVNVSP-HCKVZZMMSA-O |
| XLogP | -0.14 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|