C28H30NO+ — CID 6602043
(2R,3S,5S,6S)-1,3,5-trimethyl-2,6-diphenyl-4-(2-phenylethynyl)piperidin-1-ium-4-ol (PubChem CID 6602043) has the molecular formula C28H30NO+ and a molecular weight of 396.55 g/mol. Its IUPAC name is (2R,3S,5S,6S)-1,3,5-trimethyl-2,6-diphenyl-4-(2-phenylethynyl)piperidin-1-ium-4-ol.
| Compound Name | (2R,3S,5S,6S)-1,3,5-trimethyl-2,6-diphenyl-4-(2-phenylethynyl)piperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 6602043 |
| Molecular Formula | C28H30NO+ |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (2R,3S,5S,6S)-1,3,5-trimethyl-2,6-diphenyl-4-(2-phenylethynyl)piperidin-1-ium-4-ol |
| SMILES | C[C@H]1[C@@H](c2ccccc2)[NH+](C)[C@@H](c2ccccc2)[C@H](C)C1(O)C#Cc1ccccc1 |
| InChI | InChI=1S/C28H29NO/c1-21-26(24-15-9-5-10-16-24)29(3)27(25-17-11-6-12-18-25)22(2)28(21,30)20-19-23-13-7-4-8-14-23/h4-18,21-22,26-27,30H,1-3H3/p+1/t21-,22-,26-,27+,28?/m0/s1 |
| InChIKey | HMVLFUWQWMPWKQ-PMCZPQNESA-O |
| XLogP | 4.05 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|