C23H35N3O4 — CID 57170632
3-[(3R,5S)-5-[(6-aminohexanoylamino)methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]propanoic acid (PubChem CID 57170632) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is 3-[(3R,5S)-5-[(6-aminohexanoylamino)methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]propanoic acid.
| Compound Name | 3-[(3R,5S)-5-[(6-aminohexanoylamino)methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 57170632 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | 3-[(3R,5S)-5-[(6-aminohexanoylamino)methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]propanoic acid |
| SMILES | NCCCCCC(=O)NC[C@@H]1C[C@@H](CCC(=O)O)C(=O)N1CCCc1ccccc1 |
| InChI | InChI=1S/C23H35N3O4/c24-14-6-2-5-11-21(27)25-17-20-16-19(12-13-22(28)29)23(30)26(20)15-7-10-18-8-3-1-4-9-18/h1,3-4,8-9,19-20H,2,5-7,10-17,24H2,(H,25,27)(H,28,29)/t19-,20+/m1/s1 |
| InChIKey | LIGHMLMZPFNGMB-UXHICEINSA-N |
| XLogP | 2.34 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|