C28H39ClN2O4 — CID 70043824
ethyl 2-[(3S,5S)-5-[[4-(4-aminobutyl)phenoxy]methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]acetate;hydrochloride (PubChem CID 70043824) has the molecular formula C28H39ClN2O4 and a molecular weight of 503.08 g/mol. Its IUPAC name is ethyl 2-[(3S,5S)-5-[[4-(4-aminobutyl)phenoxy]methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]acetate;hydrochloride.
| Compound Name | ethyl 2-[(3S,5S)-5-[[4-(4-aminobutyl)phenoxy]methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 70043824 |
| Molecular Formula | C28H39ClN2O4 |
| Molecular Weight | 503.08 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | ethyl 2-[(3S,5S)-5-[[4-(4-aminobutyl)phenoxy]methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]acetate;hydrochloride |
| SMILES | CCOC(=O)C[C@@H]1C[C@@H](COc2ccc(CCCCN)cc2)N(CCCc2ccccc2)C1=O.Cl |
| InChI | InChI=1S/C28H38N2O4.ClH/c1-2-33-27(31)20-24-19-25(21-34-26-15-13-23(14-16-26)11-6-7-17-29)30(28(24)32)18-8-12-22-9-4-3-5-10-22;/h3-5,9-10,13-16,24-25H,2,6-8,11-12,17-21,29H2,1H3;1H/t24-,25-;/m0./s1 |
| InChIKey | HCGFVDXKZALBLM-DKIIUIKKSA-N |
| XLogP | 4.57 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.08 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|