C31H35N3O4S — CID 22863848
methyl 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-1-[3-(4-methylsulfanylphenyl)propyl]-2-oxopyrrolidin-3-yl]acetate (PubChem CID 22863848) has the molecular formula C31H35N3O4S and a molecular weight of 545.71 g/mol. Its IUPAC name is methyl 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-1-[3-(4-methylsulfanylphenyl)propyl]-2-oxopyrrolidin-3-yl]acetate.
| Compound Name | methyl 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-1-[3-(4-methylsulfanylphenyl)propyl]-2-oxopyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 22863848 |
| Molecular Formula | C31H35N3O4S |
| Molecular Weight | 545.71 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | methyl 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-1-[3-(4-methylsulfanylphenyl)propyl]-2-oxopyrrolidin-3-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(OC[C@@H]3C[C@@H](CC(=O)OC)C(=O)N3CCCc3ccc(SC)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H35N3O4S/c1-37-29(35)19-25-18-26(34(31(25)36)17-3-4-21-5-15-28(39-2)16-6-21)20-38-27-13-11-23(12-14-27)22-7-9-24(10-8-22)30(32)33/h5-16,25-26H,3-4,17-20H2,1-2H3,(H3,32,33)/t25-,26-/m0/s1 |
| InChIKey | ZXXGDAOIGBOIKH-UIOOFZCWSA-N |
| XLogP | 5.15 |
| TPSA | 105.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.71 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|