C31H36ClN3O6S — CID 22863722
methyl 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)-2-methylsulfonylphenoxy]methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]acetate;hydrochloride (PubChem CID 22863722) has the molecular formula C31H36ClN3O6S and a molecular weight of 614.16 g/mol. Its IUPAC name is methyl 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)-2-methylsulfonylphenoxy]methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]acetate;hydrochloride.
| Compound Name | methyl 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)-2-methylsulfonylphenoxy]methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 22863722 |
| Molecular Formula | C31H36ClN3O6S |
| Molecular Weight | 614.16 g/mol |
| Exact Mass | 613.20 |
| IUPAC Name | methyl 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)-2-methylsulfonylphenoxy]methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(-c2ccc(OC[C@@H]3C[C@@H](CC(=O)OC)C(=O)N3CCCc3ccccc3)c(S(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C31H35N3O6S.ClH/c1-39-29(35)19-25-17-26(34(31(25)36)16-6-9-21-7-4-3-5-8-21)20-40-27-15-14-24(18-28(27)41(2,37)38)22-10-12-23(13-11-22)30(32)33;/h3-5,7-8,10-15,18,25-26H,6,9,16-17,19-20H2,1-2H3,(H3,32,33);1H/t25-,26-;/m0./s1 |
| InChIKey | ICOHZTYMLZVGJJ-CCQIZPNASA-N |
| XLogP | 4.25 |
| TPSA | 139.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.16 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|