C29H31N3O4S — CID 22863836
methyl 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxo-1-(2-phenylsulfanylethyl)pyrrolidin-3-yl]acetate (PubChem CID 22863836) has the molecular formula C29H31N3O4S and a molecular weight of 517.65 g/mol. Its IUPAC name is methyl 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxo-1-(2-phenylsulfanylethyl)pyrrolidin-3-yl]acetate.
| Compound Name | methyl 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxo-1-(2-phenylsulfanylethyl)pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 22863836 |
| Molecular Formula | C29H31N3O4S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | methyl 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxo-1-(2-phenylsulfanylethyl)pyrrolidin-3-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(OC[C@@H]3C[C@@H](CC(=O)OC)C(=O)N3CCSc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H31N3O4S/c1-35-27(33)18-23-17-24(32(29(23)34)15-16-37-26-5-3-2-4-6-26)19-36-25-13-11-21(12-14-25)20-7-9-22(10-8-20)28(30)31/h2-14,23-24H,15-19H2,1H3,(H3,30,31)/t23-,24-/m0/s1 |
| InChIKey | NUXPORZRJWKXOI-ZEQRLZLVSA-N |
| XLogP | 4.59 |
| TPSA | 105.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|