C33H39N3O4 — CID 57167448
6-[(3R,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]hexanoic acid (PubChem CID 57167448) has the molecular formula C33H39N3O4 and a molecular weight of 541.69 g/mol. Its IUPAC name is 6-[(3R,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(3R,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 57167448 |
| Molecular Formula | C33H39N3O4 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.29 |
| IUPAC Name | 6-[(3R,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]hexanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(OC[C@@H]3C[C@@H](CCCCCC(=O)O)C(=O)N3CCCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H39N3O4/c34-32(35)27-15-13-25(14-16-27)26-17-19-30(20-18-26)40-23-29-22-28(11-5-2-6-12-31(37)38)33(39)36(29)21-7-10-24-8-3-1-4-9-24/h1,3-4,8-9,13-20,28-29H,2,5-7,10-12,21-23H2,(H3,34,35)(H,37,38)/t28-,29+/m1/s1 |
| InChIKey | OBOVCPUTCXILPH-WDYNHAJCSA-N |
| XLogP | 5.90 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|