C33H30N6O6 — CID 59542877
[(Z)-[amino-[4-[[5-[4-[(Z)-N'-benzoyloxycarbamimidoyl]anilino]-5-oxopentanoyl]amino]phenyl]methylidene]amino] benzoate (PubChem CID 59542877) has the molecular formula C33H30N6O6 and a molecular weight of 606.64 g/mol. Its IUPAC name is [(Z)-[amino-[4-[[5-[4-[(Z)-N'-benzoyloxycarbamimidoyl]anilino]-5-oxopentanoyl]amino]phenyl]methylidene]amino] benzoate.
| Compound Name | [(Z)-[amino-[4-[[5-[4-[(Z)-N'-benzoyloxycarbamimidoyl]anilino]-5-oxopentanoyl]amino]phenyl]methylidene]amino] benzoate |
|---|---|
| PubChem CID | 59542877 |
| Molecular Formula | C33H30N6O6 |
| Molecular Weight | 606.64 g/mol |
| Exact Mass | 606.22 |
| IUPAC Name | [(Z)-[amino-[4-[[5-[4-[(Z)-N'-benzoyloxycarbamimidoyl]anilino]-5-oxopentanoyl]amino]phenyl]methylidene]amino] benzoate |
| SMILES | N/C(=N\OC(=O)c1ccccc1)c1ccc(NC(=O)CCCC(=O)Nc2ccc(/C(N)=N/OC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H30N6O6/c34-30(38-44-32(42)24-8-3-1-4-9-24)22-14-18-26(19-15-22)36-28(40)12-7-13-29(41)37-27-20-16-23(17-21-27)31(35)39-45-33(43)25-10-5-2-6-11-25/h1-6,8-11,14-21H,7,12-13H2,(H2,34,38)(H2,35,39)(H,36,40)(H,37,41) |
| InChIKey | BMDGJOVQNMMZTE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 187.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.64 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|