C18H20N4O4S — CID 10293631
N-[3-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]sulfonylamino]phenyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 10293631) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-[3-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]sulfonylamino]phenyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | N-[3-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]sulfonylamino]phenyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 10293631 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[3-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]sulfonylamino]phenyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)Nc2cccc(NS(=O)(=O)c3ccc(/C(N)=N/O)cc3)c2)CC1 |
| InChI | InChI=1S/C18H20N4O4S/c1-18(9-10-18)17(23)20-13-3-2-4-14(11-13)22-27(25,26)15-7-5-12(6-8-15)16(19)21-24/h2-8,11,22,24H,9-10H2,1H3,(H2,19,21)(H,20,23) |
| InChIKey | MNMRSZIXNJOIDQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|