C24H30N6O4S — CID 21061350
N-[3-[[4-[5-(1,5-diaminopentyl)-1,2,4-oxadiazol-3-yl]phenyl]sulfonylamino]phenyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 21061350) has the molecular formula C24H30N6O4S and a molecular weight of 498.61 g/mol. Its IUPAC name is N-[3-[[4-[5-(1,5-diaminopentyl)-1,2,4-oxadiazol-3-yl]phenyl]sulfonylamino]phenyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | N-[3-[[4-[5-(1,5-diaminopentyl)-1,2,4-oxadiazol-3-yl]phenyl]sulfonylamino]phenyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 21061350 |
| Molecular Formula | C24H30N6O4S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | N-[3-[[4-[5-(1,5-diaminopentyl)-1,2,4-oxadiazol-3-yl]phenyl]sulfonylamino]phenyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)Nc2cccc(NS(=O)(=O)c3ccc(-c4noc(C(N)CCCCN)n4)cc3)c2)CC1 |
| InChI | InChI=1S/C24H30N6O4S/c1-24(12-13-24)23(31)27-17-5-4-6-18(15-17)30-35(32,33)19-10-8-16(9-11-19)21-28-22(34-29-21)20(26)7-2-3-14-25/h4-6,8-11,15,20,30H,2-3,7,12-14,25-26H2,1H3,(H,27,31) |
| InChIKey | ACLBPQOJPBZGAC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 166.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|