C24H31FN6O4S — CID 58714475
N-[3-[[4-[5-[(1S)-1,5-diaminopentyl]-1,2,4-oxadiazol-3-yl]phenyl]sulfonylamino]phenyl]-3-fluoro-2,2-dimethylpropanamide (PubChem CID 58714475) has the molecular formula C24H31FN6O4S and a molecular weight of 518.62 g/mol. Its IUPAC name is N-[3-[[4-[5-[(1S)-1,5-diaminopentyl]-1,2,4-oxadiazol-3-yl]phenyl]sulfonylamino]phenyl]-3-fluoro-2,2-dimethylpropanamide.
| Compound Name | N-[3-[[4-[5-[(1S)-1,5-diaminopentyl]-1,2,4-oxadiazol-3-yl]phenyl]sulfonylamino]phenyl]-3-fluoro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 58714475 |
| Molecular Formula | C24H31FN6O4S |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | N-[3-[[4-[5-[(1S)-1,5-diaminopentyl]-1,2,4-oxadiazol-3-yl]phenyl]sulfonylamino]phenyl]-3-fluoro-2,2-dimethylpropanamide |
| SMILES | CC(C)(CF)C(=O)Nc1cccc(NS(=O)(=O)c2ccc(-c3noc([C@@H](N)CCCCN)n3)cc2)c1 |
| InChI | InChI=1S/C24H31FN6O4S/c1-24(2,15-25)23(32)28-17-6-5-7-18(14-17)31-36(33,34)19-11-9-16(10-12-19)21-29-22(35-30-21)20(27)8-3-4-13-26/h5-7,9-12,14,20,31H,3-4,8,13,15,26-27H2,1-2H3,(H,28,32)/t20-/m0/s1 |
| InChIKey | DCFZTDSMZMRKDL-FQEVSTJZSA-N |
| XLogP | 3.60 |
| TPSA | 166.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|