C25H23ClN4O4S — CID 21060690
3-chloro-2,2-dimethyl-N-[3-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]sulfonylamino]phenyl]propanamide (PubChem CID 21060690) has the molecular formula C25H23ClN4O4S and a molecular weight of 511.00 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[3-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]sulfonylamino]phenyl]propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-[3-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]sulfonylamino]phenyl]propanamide |
|---|---|
| PubChem CID | 21060690 |
| Molecular Formula | C25H23ClN4O4S |
| Molecular Weight | 511.00 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[3-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]sulfonylamino]phenyl]propanamide |
| SMILES | CC(C)(CCl)C(=O)Nc1cccc(NS(=O)(=O)c2ccc(-c3nnc(-c4ccccc4)o3)cc2)c1 |
| InChI | InChI=1S/C25H23ClN4O4S/c1-25(2,16-26)24(31)27-19-9-6-10-20(15-19)30-35(32,33)21-13-11-18(12-14-21)23-29-28-22(34-23)17-7-4-3-5-8-17/h3-15,30H,16H2,1-2H3,(H,27,31) |
| InChIKey | MAWDLXJNIXLDGZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.00 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|