C25H30FN4O4S — CID 58714494
CID 58714494 (PubChem CID 58714494) has the molecular formula C25H30FN4O4S and a molecular weight of 501.60 g/mol.
| Compound Name | CID 58714494 |
|---|---|
| PubChem CID | 58714494 |
| Molecular Formula | C25H30FN4O4S |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | — |
| SMILES | CC(C)CC[CH]c1nc(-c2ccc(S(=O)(=O)Nc3ccc(NC(=O)C(C)(C)CF)cc3)cc2)no1 |
| InChI | InChI=1S/C25H30FN4O4S/c1-17(2)6-5-7-22-28-23(29-34-22)18-8-14-21(15-9-18)35(32,33)30-20-12-10-19(11-13-20)27-24(31)25(3,4)16-26/h7-15,17,30H,5-6,16H2,1-4H3,(H,27,31) |
| InChIKey | SHQCJAYIYPTSTE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |