C16H15NO4S — CID 141413711
4-(1,3-dioxo-1-phenylbutan-2-yl)benzenesulfonamide (PubChem CID 141413711) has the molecular formula C16H15NO4S and a molecular weight of 317.37 g/mol. Its IUPAC name is 4-(1,3-dioxo-1-phenylbutan-2-yl)benzenesulfonamide.
| Compound Name | 4-(1,3-dioxo-1-phenylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 141413711 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 4-(1,3-dioxo-1-phenylbutan-2-yl)benzenesulfonamide |
| SMILES | CC(=O)C(C(=O)c1ccccc1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H15NO4S/c1-11(18)15(16(19)13-5-3-2-4-6-13)12-7-9-14(10-8-12)22(17,20)21/h2-10,15H,1H3,(H2,17,20,21) |
| InChIKey | INBIWGUFILXDPD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|