C17H14N2O4S — CID 135408455
4-[1-(1-hydroxy-3-oxoinden-2-yl)ethylideneamino]benzenesulfonamide (PubChem CID 135408455) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is 4-[1-(1-hydroxy-3-oxoinden-2-yl)ethylideneamino]benzenesulfonamide.
| Compound Name | 4-[1-(1-hydroxy-3-oxoinden-2-yl)ethylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 135408455 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 4-[1-(1-hydroxy-3-oxoinden-2-yl)ethylideneamino]benzenesulfonamide |
| SMILES | C/C(=N\c1ccc(S(N)(=O)=O)cc1)C1=C(O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H14N2O4S/c1-10(19-11-6-8-12(9-7-11)24(18,22)23)15-16(20)13-4-2-3-5-14(13)17(15)21/h2-9,20H,1H3,(H2,18,22,23)/b19-10+ |
| InChIKey | KQNUGZLCJNTZMC-VXLYETTFSA-N |
| XLogP | 2.59 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|