C23H14F2N2O3 — CID 137318007
N,N'-bis(4-fluorophenyl)-1-hydroxy-3,4-dioxonaphthalene-2-carboximidamide (PubChem CID 137318007) has the molecular formula C23H14F2N2O3 and a molecular weight of 404.37 g/mol. Its IUPAC name is N,N'-bis(4-fluorophenyl)-1-hydroxy-3,4-dioxonaphthalene-2-carboximidamide.
| Compound Name | N,N'-bis(4-fluorophenyl)-1-hydroxy-3,4-dioxonaphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 137318007 |
| Molecular Formula | C23H14F2N2O3 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N,N'-bis(4-fluorophenyl)-1-hydroxy-3,4-dioxonaphthalene-2-carboximidamide |
| SMILES | O=C1C(=O)c2ccccc2C(O)=C1/C(=N/c1ccc(F)cc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C23H14F2N2O3/c24-13-5-9-15(10-6-13)26-23(27-16-11-7-14(25)8-12-16)19-20(28)17-3-1-2-4-18(17)21(29)22(19)30/h1-12,28H,(H,26,27) |
| InChIKey | YIGRMEITVRFXHO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|