C32H28CoN8O10S2-2 — CID 138394503
bis(2-[[(Z)-1-anilino-1-oxido-3-oxobut-1-en-2-yl]diazenyl]-4-sulfamoylphenolate);cobalt(2+) (PubChem CID 138394503) has the molecular formula C32H28CoN8O10S2-2 and a molecular weight of 807.69 g/mol. Its IUPAC name is bis(2-[[(Z)-1-anilino-1-oxido-3-oxobut-1-en-2-yl]diazenyl]-4-sulfamoylphenolate);cobalt(2+).
| Compound Name | bis(2-[[(Z)-1-anilino-1-oxido-3-oxobut-1-en-2-yl]diazenyl]-4-sulfamoylphenolate);cobalt(2+) |
|---|---|
| PubChem CID | 138394503 |
| Molecular Formula | C32H28CoN8O10S2-2 |
| Molecular Weight | 807.69 g/mol |
| Exact Mass | 807.07 |
| IUPAC Name | bis(2-[[(Z)-1-anilino-1-oxido-3-oxobut-1-en-2-yl]diazenyl]-4-sulfamoylphenolate);cobalt(2+) |
| SMILES | CC(=O)C(/N=N/c1cc(S(N)(=O)=O)ccc1[O-])=C(/[O-])Nc1ccccc1.CC(=O)C(/N=N/c1cc(S(N)(=O)=O)ccc1[O-])=C(/[O-])Nc1ccccc1.[Co+2] |
| InChI | InChI=1S/2C16H16N4O5S.Co/c2*1-10(21)15(16(23)18-11-5-3-2-4-6-11)20-19-13-9-12(26(17,24)25)7-8-14(13)22;/h2*2-9,18,22-23H,1H3,(H2,17,24,25);/q;;+2/p-4/b2*16-15-,20-19+; |
| InChIKey | HJXTWGYNFHYOPA-WBDILNHJSA-J |
| XLogP | 1.44 |
| TPSA | 320.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.69 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|