C11H11N3O8S — CID 137018924
3-(2,4-dioxopentan-3-yldiazenyl)-2-hydroxy-5-nitrobenzenesulfonic acid (PubChem CID 137018924) has the molecular formula C11H11N3O8S and a molecular weight of 345.29 g/mol. Its IUPAC name is 3-(2,4-dioxopentan-3-yldiazenyl)-2-hydroxy-5-nitrobenzenesulfonic acid.
| Compound Name | 3-(2,4-dioxopentan-3-yldiazenyl)-2-hydroxy-5-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 137018924 |
| Molecular Formula | C11H11N3O8S |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 3-(2,4-dioxopentan-3-yldiazenyl)-2-hydroxy-5-nitrobenzenesulfonic acid |
| SMILES | CC(=O)C(/N=N/c1cc([N+](=O)[O-])cc(S(=O)(=O)O)c1O)C(C)=O |
| InChI | InChI=1S/C11H11N3O8S/c1-5(15)10(6(2)16)13-12-8-3-7(14(18)19)4-9(11(8)17)23(20,21)22/h3-4,10,17H,1-2H3,(H,20,21,22)/b13-12+ |
| InChIKey | IYCIKWYHMRJRBH-OUKQBFOZSA-N |
| XLogP | 1.18 |
| TPSA | 176.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|