C18H17ClN4O6 — CID 101328701
N-chloro-N-(2,3-dimethoxyphenyl)-2-[(3-nitrophenyl)diazenyl]-3-oxobutanamide (PubChem CID 101328701) has the molecular formula C18H17ClN4O6 and a molecular weight of 420.81 g/mol. Its IUPAC name is N-chloro-N-(2,3-dimethoxyphenyl)-2-[(3-nitrophenyl)diazenyl]-3-oxobutanamide.
| Compound Name | N-chloro-N-(2,3-dimethoxyphenyl)-2-[(3-nitrophenyl)diazenyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 101328701 |
| Molecular Formula | C18H17ClN4O6 |
| Molecular Weight | 420.81 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | N-chloro-N-(2,3-dimethoxyphenyl)-2-[(3-nitrophenyl)diazenyl]-3-oxobutanamide |
| SMILES | COc1cccc(N(Cl)C(=O)C(/N=N/c2cccc([N+](=O)[O-])c2)C(C)=O)c1OC |
| InChI | InChI=1S/C18H17ClN4O6/c1-11(24)16(21-20-12-6-4-7-13(10-12)23(26)27)18(25)22(19)14-8-5-9-15(28-2)17(14)29-3/h4-10,16H,1-3H3/b21-20+ |
| InChIKey | VTGFTSOFXKNTIK-QZQOTICOSA-N |
| XLogP | 3.84 |
| TPSA | 123.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.81 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|