C15H12ClNO2 — CID 142644017
2-amino-1-(3-chlorophenyl)-3-phenylpropane-1,3-dione (PubChem CID 142644017) has the molecular formula C15H12ClNO2 and a molecular weight of 273.72 g/mol. Its IUPAC name is 2-amino-1-(3-chlorophenyl)-3-phenylpropane-1,3-dione.
| Compound Name | 2-amino-1-(3-chlorophenyl)-3-phenylpropane-1,3-dione |
|---|---|
| PubChem CID | 142644017 |
| Molecular Formula | C15H12ClNO2 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-amino-1-(3-chlorophenyl)-3-phenylpropane-1,3-dione |
| SMILES | NC(C(=O)c1ccccc1)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H12ClNO2/c16-12-8-4-7-11(9-12)15(19)13(17)14(18)10-5-2-1-3-6-10/h1-9,13H,17H2 |
| InChIKey | KEDDRXAIJSBLDS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|