C23H17N5O5 — CID 139230971
ethyl 10-hydroxy-9-[(3-nitrophenyl)diazenyl]-7H-pyrrolo[1,2-a]perimidine-8-carboxylate (PubChem CID 139230971) has the molecular formula C23H17N5O5 and a molecular weight of 443.42 g/mol. Its IUPAC name is ethyl 10-hydroxy-9-[(3-nitrophenyl)diazenyl]-7H-pyrrolo[1,2-a]perimidine-8-carboxylate.
| Compound Name | ethyl 10-hydroxy-9-[(3-nitrophenyl)diazenyl]-7H-pyrrolo[1,2-a]perimidine-8-carboxylate |
|---|---|
| PubChem CID | 139230971 |
| Molecular Formula | C23H17N5O5 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | ethyl 10-hydroxy-9-[(3-nitrophenyl)diazenyl]-7H-pyrrolo[1,2-a]perimidine-8-carboxylate |
| SMILES | CCOC(=O)c1c(/N=N/c2cccc([N+](=O)[O-])c2)c(O)n2c1[nH]c1cccc3cccc2c31 |
| InChI | InChI=1S/C23H17N5O5/c1-2-33-23(30)19-20(26-25-14-8-5-9-15(12-14)28(31)32)22(29)27-17-11-4-7-13-6-3-10-16(18(13)17)24-21(19)27/h3-12,24,29H,2H2,1H3/b26-25+ |
| InChIKey | OTPHMUJBWCHICJ-OCEACIFDSA-N |
| XLogP | 5.78 |
| TPSA | 134.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|