C17H15ClN4O7S2 — CID 135979706
2-[[2-(2-chloro-5-sulfophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-5-methylbenzenesulfonic acid (PubChem CID 135979706) has the molecular formula C17H15ClN4O7S2 and a molecular weight of 486.92 g/mol. Its IUPAC name is 2-[[2-(2-chloro-5-sulfophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-5-methylbenzenesulfonic acid.
| Compound Name | 2-[[2-(2-chloro-5-sulfophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 135979706 |
| Molecular Formula | C17H15ClN4O7S2 |
| Molecular Weight | 486.92 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | 2-[[2-(2-chloro-5-sulfophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-5-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(/N=N/c2c(C)[nH]n(-c3cc(S(=O)(=O)O)ccc3Cl)c2=O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C17H15ClN4O7S2/c1-9-3-6-13(15(7-9)31(27,28)29)19-20-16-10(2)21-22(17(16)23)14-8-11(30(24,25)26)4-5-12(14)18/h3-8,21H,1-2H3,(H,24,25,26)(H,27,28,29)/b20-19+ |
| InChIKey | ASMIEXMXSSISSS-FMQUCBEESA-N |
| XLogP | 3.34 |
| TPSA | 171.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.92 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|