C19H11Cl4N7O7S2 — CID 136744380
2,5-dichloro-4-[4-[[5-(4,6-dichloro-1,3,5-triazin-2-yl)-2-sulfophenyl]diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid (PubChem CID 136744380) has the molecular formula C19H11Cl4N7O7S2 and a molecular weight of 655.29 g/mol. Its IUPAC name is 2,5-dichloro-4-[4-[[5-(4,6-dichloro-1,3,5-triazin-2-yl)-2-sulfophenyl]diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid.
| Compound Name | 2,5-dichloro-4-[4-[[5-(4,6-dichloro-1,3,5-triazin-2-yl)-2-sulfophenyl]diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136744380 |
| Molecular Formula | C19H11Cl4N7O7S2 |
| Molecular Weight | 655.29 g/mol |
| Exact Mass | 652.89 |
| IUPAC Name | 2,5-dichloro-4-[4-[[5-(4,6-dichloro-1,3,5-triazin-2-yl)-2-sulfophenyl]diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid |
| SMILES | Cc1[nH]n(-c2cc(Cl)c(S(=O)(=O)O)cc2Cl)c(=O)c1/N=N/c1cc(-c2nc(Cl)nc(Cl)n2)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C19H11Cl4N7O7S2/c1-7-15(17(31)30(29-7)12-5-10(21)14(6-9(12)20)39(35,36)37)28-27-11-4-8(2-3-13(11)38(32,33)34)16-24-18(22)26-19(23)25-16/h2-6,29H,1H3,(H,32,33,34)(H,35,36,37)/b28-27+ |
| InChIKey | XWGBOZSBYHZOEY-BYYHNAKLSA-N |
| XLogP | 4.85 |
| TPSA | 209.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.29 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|