C18H15ClN4O9S2 — CID 135979693
2-(2-chloro-6-methyl-4-sulfophenyl)-4-[(4-methyl-2-sulfophenyl)diazenyl]-3-oxo-1H-pyrazole-5-carboxylic acid (PubChem CID 135979693) has the molecular formula C18H15ClN4O9S2 and a molecular weight of 530.92 g/mol. Its IUPAC name is 2-(2-chloro-6-methyl-4-sulfophenyl)-4-[(4-methyl-2-sulfophenyl)diazenyl]-3-oxo-1H-pyrazole-5-carboxylic acid.
| Compound Name | 2-(2-chloro-6-methyl-4-sulfophenyl)-4-[(4-methyl-2-sulfophenyl)diazenyl]-3-oxo-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 135979693 |
| Molecular Formula | C18H15ClN4O9S2 |
| Molecular Weight | 530.92 g/mol |
| Exact Mass | 530.00 |
| IUPAC Name | 2-(2-chloro-6-methyl-4-sulfophenyl)-4-[(4-methyl-2-sulfophenyl)diazenyl]-3-oxo-1H-pyrazole-5-carboxylic acid |
| SMILES | Cc1ccc(/N=N/c2c(C(=O)O)[nH]n(-c3c(C)cc(S(=O)(=O)O)cc3Cl)c2=O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H15ClN4O9S2/c1-8-3-4-12(13(5-8)34(30,31)32)20-21-14-15(18(25)26)22-23(17(14)24)16-9(2)6-10(7-11(16)19)33(27,28)29/h3-7,22H,1-2H3,(H,25,26)(H,27,28,29)(H,30,31,32)/b21-20+ |
| InChIKey | IQJHHTXZGFCEKR-QZQOTICOSA-N |
| XLogP | 3.04 |
| TPSA | 208.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.92 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|