C16H9Cl2MnN4O6S+ — CID 170842141
4-[(2,5-dichloro-4-sulfophenyl)diazenyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate;manganese(2+) (PubChem CID 170842141) has the molecular formula C16H9Cl2MnN4O6S+ and a molecular weight of 511.18 g/mol. Its IUPAC name is 4-[(2,5-dichloro-4-sulfophenyl)diazenyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate;manganese(2+).
| Compound Name | 4-[(2,5-dichloro-4-sulfophenyl)diazenyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate;manganese(2+) |
|---|---|
| PubChem CID | 170842141 |
| Molecular Formula | C16H9Cl2MnN4O6S+ |
| Molecular Weight | 511.18 g/mol |
| Exact Mass | 509.90 |
| IUPAC Name | 4-[(2,5-dichloro-4-sulfophenyl)diazenyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate;manganese(2+) |
| SMILES | O=C([O-])c1[nH]n(-c2ccccc2)c(=O)c1/N=N/c1cc(Cl)c(S(=O)(=O)O)cc1Cl.[Mn+2] |
| InChI | InChI=1S/C16H10Cl2N4O6S.Mn/c17-9-7-12(29(26,27)28)10(18)6-11(9)19-20-13-14(16(24)25)21-22(15(13)23)8-4-2-1-3-5-8;/h1-7,21H,(H,24,25)(H,26,27,28);/q;+2/p-1/b20-19+; |
| InChIKey | VAXKVOCPVUTPDV-RZLHGTIFSA-M |
| XLogP | 2.50 |
| TPSA | 157.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.18 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|