C17H14N4O12S3 — CID 135979714
4-[[4-methyl-2-sulfo-5-(trioxidanylsulfanyl)phenyl]diazenyl]-3-oxo-2-(4-sulfophenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 135979714) has the molecular formula C17H14N4O12S3 and a molecular weight of 562.52 g/mol. Its IUPAC name is 4-[[4-methyl-2-sulfo-5-(trioxidanylsulfanyl)phenyl]diazenyl]-3-oxo-2-(4-sulfophenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 4-[[4-methyl-2-sulfo-5-(trioxidanylsulfanyl)phenyl]diazenyl]-3-oxo-2-(4-sulfophenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 135979714 |
| Molecular Formula | C17H14N4O12S3 |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 561.98 |
| IUPAC Name | 4-[[4-methyl-2-sulfo-5-(trioxidanylsulfanyl)phenyl]diazenyl]-3-oxo-2-(4-sulfophenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c(/N=N/c2c(C(=O)O)[nH]n(-c3ccc(S(=O)(=O)O)cc3)c2=O)cc1SOOO |
| InChI | InChI=1S/C17H14N4O12S3/c1-8-6-13(36(29,30)31)11(7-12(8)34-33-32-25)18-19-14-15(17(23)24)20-21(16(14)22)9-2-4-10(5-3-9)35(26,27)28/h2-7,20,25H,1H3,(H,23,24)(H,26,27,28)(H,29,30,31)/b19-18+ |
| InChIKey | OROVQRPYGVWVDQ-VHEBQXMUSA-N |
| XLogP | 2.51 |
| TPSA | 247.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|