C16H11N6O5- — CID 135769253
4-[(5-amino-3-oxo-2-phenyl-1H-pyrazol-4-yl)diazenyl]-3-nitrobenzoate (PubChem CID 135769253) has the molecular formula C16H11N6O5- and a molecular weight of 367.30 g/mol. Its IUPAC name is 4-[(5-amino-3-oxo-2-phenyl-1H-pyrazol-4-yl)diazenyl]-3-nitrobenzoate.
| Compound Name | 4-[(5-amino-3-oxo-2-phenyl-1H-pyrazol-4-yl)diazenyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 135769253 |
| Molecular Formula | C16H11N6O5- |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 4-[(5-amino-3-oxo-2-phenyl-1H-pyrazol-4-yl)diazenyl]-3-nitrobenzoate |
| SMILES | Nc1[nH]n(-c2ccccc2)c(=O)c1/N=N/c1ccc(C(=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12N6O5/c17-14-13(15(23)21(20-14)10-4-2-1-3-5-10)19-18-11-7-6-9(16(24)25)8-12(11)22(26)27/h1-8,20H,17H2,(H,24,25)/p-1/b19-18+ |
| InChIKey | ZBFJDNVXQIZPTE-VHEBQXMUSA-M |
| XLogP | 1.43 |
| TPSA | 171.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|