C19H18N6O2 — CID 1042752
4-[(1-acetyl-2,3-dihydroindol-5-yl)diazenyl]-5-amino-2-phenyl-1H-pyrazol-3-one (PubChem CID 1042752) has the molecular formula C19H18N6O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-[(1-acetyl-2,3-dihydroindol-5-yl)diazenyl]-5-amino-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 4-[(1-acetyl-2,3-dihydroindol-5-yl)diazenyl]-5-amino-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 1042752 |
| Molecular Formula | C19H18N6O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-[(1-acetyl-2,3-dihydroindol-5-yl)diazenyl]-5-amino-2-phenyl-1H-pyrazol-3-one |
| SMILES | CC(=O)N1CCc2cc(/N=N/c3c(N)[nH]n(-c4ccccc4)c3=O)ccc21 |
| InChI | InChI=1S/C19H18N6O2/c1-12(26)24-10-9-13-11-14(7-8-16(13)24)21-22-17-18(20)23-25(19(17)27)15-5-3-2-4-6-15/h2-8,11,23H,9-10,20H2,1H3/b22-21+ |
| InChIKey | FVXMOSCFPXFIKM-QURGRASLSA-N |
| XLogP | 3.07 |
| TPSA | 108.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|