C17H16ClCoN5O4S+2 — CID 135602174
3-[[2-(4-chlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-4-hydroxy-N-methylbenzenesulfonamide;cobalt(2+) (PubChem CID 135602174) has the molecular formula C17H16ClCoN5O4S+2 and a molecular weight of 480.80 g/mol. Its IUPAC name is 3-[[2-(4-chlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-4-hydroxy-N-methylbenzenesulfonamide;cobalt(2+).
| Compound Name | 3-[[2-(4-chlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-4-hydroxy-N-methylbenzenesulfonamide;cobalt(2+) |
|---|---|
| PubChem CID | 135602174 |
| Molecular Formula | C17H16ClCoN5O4S+2 |
| Molecular Weight | 480.80 g/mol |
| Exact Mass | 479.99 |
| IUPAC Name | 3-[[2-(4-chlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-4-hydroxy-N-methylbenzenesulfonamide;cobalt(2+) |
| SMILES | CNS(=O)(=O)c1ccc(O)c(/N=N/c2c(C)[nH]n(-c3ccc(Cl)cc3)c2=O)c1.[Co+2] |
| InChI | InChI=1S/C17H16ClN5O4S.Co/c1-10-16(17(25)23(22-10)12-5-3-11(18)4-6-12)21-20-14-9-13(7-8-15(14)24)28(26,27)19-2;/h3-9,19,22,24H,1-2H3;/q;+2/b21-20+; |
| InChIKey | VDLXNWZUNIGYEY-ANVLNOONSA-N |
| XLogP | 3.15 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.80 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|