C20H19Cl2N9O4S — CID 135548786
3-[[2-[3-[(4,6-dichloro-1,4-dihydro-1,3,5-triazin-2-yl)amino]phenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-4-hydroxy-N-methylbenzenesulfonamide (PubChem CID 135548786) has the molecular formula C20H19Cl2N9O4S and a molecular weight of 552.40 g/mol. Its IUPAC name is 3-[[2-[3-[(4,6-dichloro-1,4-dihydro-1,3,5-triazin-2-yl)amino]phenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-4-hydroxy-N-methylbenzenesulfonamide.
| Compound Name | 3-[[2-[3-[(4,6-dichloro-1,4-dihydro-1,3,5-triazin-2-yl)amino]phenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-4-hydroxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 135548786 |
| Molecular Formula | C20H19Cl2N9O4S |
| Molecular Weight | 552.40 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | 3-[[2-[3-[(4,6-dichloro-1,4-dihydro-1,3,5-triazin-2-yl)amino]phenyl]-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-4-hydroxy-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(O)c(/N=N/c2c(C)[nH]n(-c3cccc(NC4=NC(Cl)N=C(Cl)N4)c3)c2=O)c1 |
| InChI | InChI=1S/C20H19Cl2N9O4S/c1-10-16(29-28-14-9-13(6-7-15(14)32)36(34,35)23-2)17(33)31(30-10)12-5-3-4-11(8-12)24-20-26-18(21)25-19(22)27-20/h3-9,18,23,30,32H,1-2H3,(H2,24,25,26,27)/b29-28+ |
| InChIKey | ZQICVTMUKLUTNH-ZQHSETAFSA-N |
| XLogP | 2.99 |
| TPSA | 177.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|