C32H27ClN10Na2O9S3 — CID 170841054
CID 170841054 (PubChem CID 170841054) has the molecular formula C32H27ClN10Na2O9S3 and a molecular weight of 873.26 g/mol.
| Compound Name | CID 170841054 |
|---|---|
| PubChem CID | 170841054 |
| Molecular Formula | C32H27ClN10Na2O9S3 |
| Molecular Weight | 873.26 g/mol |
| Exact Mass | 872.06 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\O)c1c(C)c(/N=N/c2cc(/N=c3\nc(Nc4ccc(-c5nc6ccc(C)c(S(=O)(=O)O)c6s5)cc4)nc(Cl)[nH]3)ccc2S(=O)(=O)O)c(O)n(CC)c1=O.[Na].[Na] |
| InChI | InChI=1S/C32H27ClN10O9S3.2Na/c1-4-43-28(45)22(26(34)44)15(3)23(29(43)46)42-41-20-13-18(10-12-21(20)54(47,48)49)36-32-39-30(33)38-31(40-32)35-17-8-6-16(7-9-17)27-37-19-11-5-14(2)25(24(19)53-27)55(50,51)52;;/h5-13,46H,4H2,1-3H3,(H2,34,44)(H,47,48,49)(H,50,51,52)(H2,35,36,38,39,40);;/b42-41+;; |
| InChIKey | CMBULVYQISQMOS-NZWRDQTFSA-N |
| XLogP | 5.25 |
| TPSA | 298.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.26 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|