C16H18N4O9S2 — CID 161081267
4-[(1-ethyl-5-formamido-2-hydroxy-4-methyl-6-oxo-3-pyridinyl)diazenyl]-2-methylbenzenesulfonic acid;sulfur trioxide (PubChem CID 161081267) has the molecular formula C16H18N4O9S2 and a molecular weight of 474.47 g/mol. Its IUPAC name is 4-[(1-ethyl-5-formamido-2-hydroxy-4-methyl-6-oxo-3-pyridinyl)diazenyl]-2-methylbenzenesulfonic acid;sulfur trioxide.
| Compound Name | 4-[(1-ethyl-5-formamido-2-hydroxy-4-methyl-6-oxo-3-pyridinyl)diazenyl]-2-methylbenzenesulfonic acid;sulfur trioxide |
|---|---|
| PubChem CID | 161081267 |
| Molecular Formula | C16H18N4O9S2 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | 4-[(1-ethyl-5-formamido-2-hydroxy-4-methyl-6-oxo-3-pyridinyl)diazenyl]-2-methylbenzenesulfonic acid;sulfur trioxide |
| SMILES | CCn1c(O)c(/N=N/c2ccc(S(=O)(=O)O)c(C)c2)c(C)c(NC=O)c1=O.O=S(=O)=O |
| InChI | InChI=1S/C16H18N4O6S.O3S/c1-4-20-15(22)13(17-8-21)10(3)14(16(20)23)19-18-11-5-6-12(9(2)7-11)27(24,25)26;1-4(2)3/h5-8,23H,4H2,1-3H3,(H,17,21)(H,24,25,26);/b19-18+; |
| InChIKey | UFYDZLHCTXGOHA-LTRPLHCISA-N |
| XLogP | 1.42 |
| TPSA | 201.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|